C34H25FN4O6 — CID 4130995
N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide (PubChem CID 4130995) has the molecular formula C34H25FN4O6 and a molecular weight of 604.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 4130995 |
| Molecular Formula | C34H25FN4O6 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,3-dioxoindol-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C1C(=O)N(CC(=O)N(Cc2ccc(F)cc2)C(C(=O)Nc2ccc3c(c2)OCO3)c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C34H25FN4O6/c35-21-11-9-20(10-12-21)17-39(30(40)18-38-27-8-4-2-6-24(27)32(41)34(38)43)31(25-16-36-26-7-3-1-5-23(25)26)33(42)37-22-13-14-28-29(15-22)45-19-44-28/h1-16,31,36H,17-19H2,(H,37,42) |
| InChIKey | QTNIWKNBAFJTMB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|