About 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene
1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 4131080) has the molecular formula C21H28O
and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| PubChem CID | 4131080 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28O/c1-20(2,3)16-21(4,5)18-11-13-19(14-12-18)22-15-17-9-7-6-8-10-17/h6-14H,15-16H2,1-5H3 |
| InChIKey | GQFZXKVFJPVNDS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene?
The IUPAC name of 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (CID 4131080) is 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
What is the SMILES notation for 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene?
The canonical SMILES for 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene is CC(C)(C)CC(C)(C)c1ccc(OCc2ccccc2)cc1.
What is the InChIKey of 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene?
The InChIKey is GQFZXKVFJPVNDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O/c1-20(2,3)16-21(4,5)18-11-13-19(14-12-18)22-15-17-9-7-6-8-10-17/h6-14H,15-16H2,1-5H3.
What are the key properties of 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene?
1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene has a molecular weight of 296.45 g/mol, XLogP of 5.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxy-4-(2,4,4-trimethylpentan-2-yl)benzene is sourced from PubChem (CID 4131080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).