C16H12Cl2FN3O2 — CID 4131259
2,4-dichloro-N-[2-[2-[(3-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 4131259) has the molecular formula C16H12Cl2FN3O2 and a molecular weight of 368.20 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-[(3-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[2-[(3-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4131259 |
| Molecular Formula | C16H12Cl2FN3O2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-[(3-fluorophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)NN=Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H12Cl2FN3O2/c17-11-4-5-13(14(18)7-11)16(24)20-9-15(23)22-21-8-10-2-1-3-12(19)6-10/h1-8H,9H2,(H,20,24)(H,22,23) |
| InChIKey | DCQSEKHHBRWYAR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|