C16H15Br2NO4 — CID 41316970
6,8-dibromo-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]chromen-2-one (PubChem CID 41316970) has the molecular formula C16H15Br2NO4 and a molecular weight of 445.11 g/mol. Its IUPAC name is 6,8-dibromo-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 41316970 |
| Molecular Formula | C16H15Br2NO4 |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 6,8-dibromo-3-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]chromen-2-one |
| SMILES | C[C@@H]1CN(C(=O)c2cc3cc(Br)cc(Br)c3oc2=O)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H15Br2NO4/c1-8-6-19(7-9(2)22-8)15(20)12-4-10-3-11(17)5-13(18)14(10)23-16(12)21/h3-5,8-9H,6-7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | BLIHUZYNQFKCSS-RKDXNWHRSA-N |
| XLogP | 3.57 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|