C26H25ClN2O3S2 — CID 41320171
N-benzyl-4-(4-chlorophenyl)sulfonyl-N-(6-ethyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 41320171) has the molecular formula C26H25ClN2O3S2 and a molecular weight of 513.08 g/mol. Its IUPAC name is N-benzyl-4-(4-chlorophenyl)sulfonyl-N-(6-ethyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-N-(6-ethyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41320171 |
| Molecular Formula | C26H25ClN2O3S2 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | N-benzyl-4-(4-chlorophenyl)sulfonyl-N-(6-ethyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCc1ccc2nc(N(Cc3ccccc3)C(=O)CCCS(=O)(=O)c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C26H25ClN2O3S2/c1-2-19-10-15-23-24(17-19)33-26(28-23)29(18-20-7-4-3-5-8-20)25(30)9-6-16-34(31,32)22-13-11-21(27)12-14-22/h3-5,7-8,10-15,17H,2,6,9,16,18H2,1H3 |
| InChIKey | GXYKIQDEZMEBPX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |