C16H17NO2S — CID 41320624
N-benzyl-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 41320624) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-benzyl-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-benzyl-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 41320624 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-benzyl-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | COc1ccc(SCC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO2S/c1-19-14-7-9-15(10-8-14)20-12-16(18)17-11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,17,18) |
| InChIKey | VWTBDCZRSYOHHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |