About N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide
N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide (PubChem CID 4132561) has the molecular formula C14H11N3O5
and a molecular weight of 301.26 g/mol. Its IUPAC name is N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide |
| PubChem CID | 4132561 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1[N+](=O)[O-])OCCO2)c1cccnc1 |
| InChI | InChI=1S/C14H11N3O5/c18-14(9-2-1-3-15-8-9)16-10-6-12-13(22-5-4-21-12)7-11(10)17(19)20/h1-3,6-8H,4-5H2,(H,16,18) |
| InChIKey | SSGRUUFQGQBOCS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide?
The IUPAC name of N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide (CID 4132561) is N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide.
What is the SMILES notation for N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide?
The canonical SMILES for N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide is O=C(Nc1cc2c(cc1[N+](=O)[O-])OCCO2)c1cccnc1.
What is the InChIKey of N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide?
The InChIKey is SSGRUUFQGQBOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O5/c18-14(9-2-1-3-15-8-9)16-10-6-12-13(22-5-4-21-12)7-11(10)17(19)20/h1-3,6-8H,4-5H2,(H,16,18).
What are the key properties of N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide?
N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide has a molecular weight of 301.26 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)pyridine-3-carboxamide is sourced from PubChem (CID 4132561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).