C23H17BrN2O6 — CID 41329975
[(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 41329975) has the molecular formula C23H17BrN2O6 and a molecular weight of 497.30 g/mol. Its IUPAC name is [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 41329975 |
| Molecular Formula | C23H17BrN2O6 |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)O[C@@H](C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H17BrN2O6/c24-18-10-6-17(7-11-18)23(29)25-14-20(27)32-22(21(28)15-4-2-1-3-5-15)16-8-12-19(13-9-16)26(30)31/h1-13,22H,14H2,(H,25,29)/t22-/m1/s1 |
| InChIKey | PTJJHDGIBISIOQ-JOCHJYFZSA-N |
| XLogP | 4.25 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|