C15H12BrCl3N2O3S — CID 41330979
(2S)-2-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 41330979) has the molecular formula C15H12BrCl3N2O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 41330979 |
| Molecular Formula | C15H12BrCl3N2O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 483.88 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12BrCl3N2O3S/c1-8(21-25(23,24)10-4-2-9(16)3-5-10)15(22)20-14-7-12(18)11(17)6-13(14)19/h2-8,21H,1H3,(H,20,22)/t8-/m0/s1 |
| InChIKey | VAQAZTZOFXZBTH-QMMMGPOBSA-N |
| XLogP | 4.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|