About methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate
methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate (PubChem CID 4133271) has the molecular formula C18H15NO4S
and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate.
Molecular Properties
| Compound Name | methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate |
| PubChem CID | 4133271 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1SC1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H15NO4S/c1-23-18(22)13-9-5-6-10-14(13)24-15-11-16(20)19(17(15)21)12-7-3-2-4-8-12/h2-10,15H,11H2,1H3 |
| InChIKey | FGVRWAVMOLPJKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate?
The IUPAC name of methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate (CID 4133271) is methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate.
What is the SMILES notation for methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate?
The canonical SMILES for methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate is COC(=O)c1ccccc1SC1CC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate?
The InChIKey is FGVRWAVMOLPJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4S/c1-23-18(22)13-9-5-6-10-14(13)24-15-11-16(20)19(17(15)21)12-7-3-2-4-8-12/h2-10,15H,11H2,1H3.
What are the key properties of methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate?
methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate has a molecular weight of 341.39 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylbenzoate is sourced from PubChem (CID 4133271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).