C17H7F17O3 — CID 4133302
methyl 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoate (PubChem CID 4133302) has the molecular formula C17H7F17O3 and a molecular weight of 582.21 g/mol. Its IUPAC name is methyl 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoate.
| Compound Name | methyl 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 4133302 |
| Molecular Formula | C17H7F17O3 |
| Molecular Weight | 582.21 g/mol |
| Exact Mass | 582.01 |
| IUPAC Name | methyl 4-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H7F17O3/c1-36-10(35)6-2-4-7(5-3-6)37-9(13(20,21)22)8(11(18,14(23,24)25)15(26,27)28)12(19,16(29,30)31)17(32,33)34/h2-5H,1H3 |
| InChIKey | IQHBQABYZVSJRR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.21 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|