C24H32N4O5S — CID 4133373
4-[[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)methylideneamino]methyl]benzenesulfonamide (PubChem CID 4133373) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)methylideneamino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)methylideneamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4133373 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-[[(1,3-dicyclohexyl-4-hydroxy-2,6-dioxopyrimidin-5-yl)methylideneamino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C/N=C/c2c(O)n(C3CCCCC3)c(=O)n(C3CCCCC3)c2=O)cc1 |
| InChI | InChI=1S/C24H32N4O5S/c25-34(32,33)20-13-11-17(12-14-20)15-26-16-21-22(29)27(18-7-3-1-4-8-18)24(31)28(23(21)30)19-9-5-2-6-10-19/h11-14,16,18-19,29H,1-10,15H2,(H2,25,32,33)/b26-16+ |
| InChIKey | ZPSNSAWHXDUUPU-WGOQTCKBSA-N |
| XLogP | 2.99 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|