About 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate
2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate (PubChem CID 4133394) has the molecular formula C11H12NO6-
and a molecular weight of 254.22 g/mol. Its IUPAC name is 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate.
Molecular Properties
| Compound Name | 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate |
| PubChem CID | 4133394 |
| Molecular Formula | C11H12NO6- |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate |
| SMILES | O=C([O-])C[NH+](CC(=O)[O-])Cc1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO6/c13-8-2-1-7(9(14)3-8)4-12(5-10(15)16)6-11(17)18/h1-3,13-14H,4-6H2,(H,15,16)(H,17,18)/p-1 |
| InChIKey | RUJCPBLFBWDYRR-UHFFFAOYSA-M |
| XLogP | -4.02 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate?
The IUPAC name of 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate (CID 4133394) is 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate.
What is the SMILES notation for 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate?
The canonical SMILES for 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate is O=C([O-])C[NH+](CC(=O)[O-])Cc1ccc(O)cc1O.
What is the InChIKey of 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate?
The InChIKey is RUJCPBLFBWDYRR-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13NO6/c13-8-2-1-7(9(14)3-8)4-12(5-10(15)16)6-11(17)18/h1-3,13-14H,4-6H2,(H,15,16)(H,17,18)/p-1.
What are the key properties of 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate?
2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate has a molecular weight of 254.22 g/mol, XLogP of -4.02, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxylatomethyl-[(2,4-dihydroxyphenyl)methyl]azaniumyl]acetate is sourced from PubChem (CID 4133394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).