About methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate
methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate (PubChem CID 4133435) has the molecular formula C17H25N2O4+
and a molecular weight of 321.40 g/mol. Its IUPAC name is methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 4133435 |
| Molecular Formula | C17H25N2O4+ |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate |
| SMILES | COC(=O)c1cc2oc(C)c(C)c2n1CC(O)C[NH+]1CCCC1 |
| InChI | InChI=1S/C17H24N2O4/c1-11-12(2)23-15-8-14(17(21)22-3)19(16(11)15)10-13(20)9-18-6-4-5-7-18/h8,13,20H,4-7,9-10H2,1-3H3/p+1 |
| InChIKey | PKCTTWMNJLLFPA-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate (CID 4133435) is methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate is COC(=O)c1cc2oc(C)c(C)c2n1CC(O)C[NH+]1CCCC1.
What is the InChIKey of methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate?
The InChIKey is PKCTTWMNJLLFPA-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H24N2O4/c1-11-12(2)23-15-8-14(17(21)22-3)19(16(11)15)10-13(20)9-18-6-4-5-7-18/h8,13,20H,4-7,9-10H2,1-3H3/p+1.
What are the key properties of methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate?
methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate has a molecular weight of 321.40 g/mol, XLogP of 0.68, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl)-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 4133435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).