C16H12BrF6N3O2 — CID 4133912
N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-methoxybenzamide (PubChem CID 4133912) has the molecular formula C16H12BrF6N3O2 and a molecular weight of 472.18 g/mol. Its IUPAC name is N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4133912 |
| Molecular Formula | C16H12BrF6N3O2 |
| Molecular Weight | 472.18 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | N-[2-[(5-bromo-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(Nc2ccc(Br)cn2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12BrF6N3O2/c1-28-11-5-2-9(3-6-11)13(27)26-14(15(18,19)20,16(21,22)23)25-12-7-4-10(17)8-24-12/h2-8H,1H3,(H,24,25)(H,26,27) |
| InChIKey | MSVFJWSEECDEJA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.18 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|