About 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol
4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol (PubChem CID 4134035) has the molecular formula C21H26O2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol.
Molecular Properties
| Compound Name | 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol |
| PubChem CID | 4134035 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol |
| SMILES | CC1CC(C)(C)CC(c2ccc(O)cc2)(c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C21H26O2/c1-15-12-20(2,3)14-21(13-15,16-4-8-18(22)9-5-16)17-6-10-19(23)11-7-17/h4-11,15,22-23H,12-14H2,1-3H3 |
| InChIKey | UMPGNGRIGSEMTC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol?
The IUPAC name of 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol (CID 4134035) is 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol.
What is the SMILES notation for 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol?
The canonical SMILES for 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol is CC1CC(C)(C)CC(c2ccc(O)cc2)(c2ccc(O)cc2)C1.
What is the InChIKey of 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol?
The InChIKey is UMPGNGRIGSEMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2/c1-15-12-20(2,3)14-21(13-15,16-4-8-18(22)9-5-16)17-6-10-19(23)11-7-17/h4-11,15,22-23H,12-14H2,1-3H3.
What are the key properties of 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol?
4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol has a molecular weight of 310.44 g/mol, XLogP of 5.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol is sourced from PubChem (CID 4134035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).