About N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide
N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide (PubChem CID 4134110) has the molecular formula C16H13F2NO
and a molecular weight of 273.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide |
| PubChem CID | 4134110 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13F2NO/c17-13-6-12(7-14(18)9-13)16(20)19-15-5-4-10-2-1-3-11(10)8-15/h4-9H,1-3H2,(H,19,20) |
| InChIKey | GYXFKHFHBSAPNZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide?
The IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide (CID 4134110) is N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide?
The canonical SMILES for N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide is O=C(Nc1ccc2c(c1)CCC2)c1cc(F)cc(F)c1.
What is the InChIKey of N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide?
The InChIKey is GYXFKHFHBSAPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO/c17-13-6-12(7-14(18)9-13)16(20)19-15-5-4-10-2-1-3-11(10)8-15/h4-9H,1-3H2,(H,19,20).
What are the key properties of N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide?
N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide has a molecular weight of 273.28 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-5-yl)-3,5-difluorobenzamide is sourced from PubChem (CID 4134110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).