C14H14N2O3S2 — CID 41342430
N-(1-ethyl-2-oxo-3H-indol-5-yl)thiophene-2-sulfonamide (PubChem CID 41342430) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(1-ethyl-2-oxo-3H-indol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(1-ethyl-2-oxo-3H-indol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 41342430 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-(1-ethyl-2-oxo-3H-indol-5-yl)thiophene-2-sulfonamide |
| SMILES | CCN1C(=O)Cc2cc(NS(=O)(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C14H14N2O3S2/c1-2-16-12-6-5-11(8-10(12)9-13(16)17)15-21(18,19)14-4-3-7-20-14/h3-8,15H,2,9H2,1H3 |
| InChIKey | HSLUVLRABLJOQW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |