C16H15FN2O3S — CID 41342517
1-(4-fluorophenyl)-N-(1-methyl-2-oxo-3H-indol-5-yl)methanesulfonamide (PubChem CID 41342517) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(1-methyl-2-oxo-3H-indol-5-yl)methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-(1-methyl-2-oxo-3H-indol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 41342517 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(1-methyl-2-oxo-3H-indol-5-yl)methanesulfonamide |
| SMILES | CN1C(=O)Cc2cc(NS(=O)(=O)Cc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H15FN2O3S/c1-19-15-7-6-14(8-12(15)9-16(19)20)18-23(21,22)10-11-2-4-13(17)5-3-11/h2-8,18H,9-10H2,1H3 |
| InChIKey | BMXYSNFXBCXVSQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |