C19H20IN3O2S — CID 41344324
N-[2-(dimethylamino)ethyl]-2-iodo-N-(5-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41344324) has the molecular formula C19H20IN3O2S and a molecular weight of 481.36 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-iodo-N-(5-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-iodo-N-(5-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41344324 |
| Molecular Formula | C19H20IN3O2S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-iodo-N-(5-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2sc(N(CCN(C)C)C(=O)c3ccccc3I)nc2c1 |
| InChI | InChI=1S/C19H20IN3O2S/c1-22(2)10-11-23(18(24)14-6-4-5-7-15(14)20)19-21-16-12-13(25-3)8-9-17(16)26-19/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | SJBFEJSCSCBPMX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|