C20H21FIN3OS — CID 41345648
N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-iodobenzamide (PubChem CID 41345648) has the molecular formula C20H21FIN3OS and a molecular weight of 497.38 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-iodobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 41345648 |
| Molecular Formula | C20H21FIN3OS |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-iodobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccccc1I)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C20H21FIN3OS/c1-3-24(4-2)12-13-25(19(26)14-8-5-6-10-16(14)22)20-23-18-15(21)9-7-11-17(18)27-20/h5-11H,3-4,12-13H2,1-2H3 |
| InChIKey | KNOQFJSFNHMRLZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|