C25H27N3O5S — CID 41346632
N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 41346632) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 41346632 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc2ccccc2oc1=O)c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C25H27N3O5S/c1-5-27(6-2)13-14-28(23(29)17-15-16-9-7-8-10-18(16)33-24(17)30)25-26-21-19(31-3)11-12-20(32-4)22(21)34-25/h7-12,15H,5-6,13-14H2,1-4H3 |
| InChIKey | HATHLCXCKBGPAG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|