C20H8F5N3O4 — CID 4134792
4-nitro-2-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol (PubChem CID 4134792) has the molecular formula C20H8F5N3O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is 4-nitro-2-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol.
| Compound Name | 4-nitro-2-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 4134792 |
| Molecular Formula | C20H8F5N3O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 4-nitro-2-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2ccc3oc(-c4c(F)c(F)c(F)c(F)c4F)nc3c2)c1 |
| InChI | InChI=1S/C20H8F5N3O4/c21-15-14(16(22)18(24)19(25)17(15)23)20-27-11-6-9(1-4-13(11)32-20)26-7-8-5-10(28(30)31)2-3-12(8)29/h1-7,29H/b26-7+ |
| InChIKey | LCHXCIILDVDBTD-IOXBOXJCSA-N |
| XLogP | 5.55 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|