C17H25Cl2N3O3S — CID 41349722
3-chloro-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylethyl]-2,2-dimethylpropanamide (PubChem CID 41349722) has the molecular formula C17H25Cl2N3O3S and a molecular weight of 422.38 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 41349722 |
| Molecular Formula | C17H25Cl2N3O3S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-chloro-N-[2-[4-(2-chlorophenyl)piperazin-1-yl]sulfonylethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NCCS(=O)(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O3S/c1-17(2,13-18)16(23)20-7-12-26(24,25)22-10-8-21(9-11-22)15-6-4-3-5-14(15)19/h3-6H,7-13H2,1-2H3,(H,20,23) |
| InChIKey | LZFIKPYORODIOK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|