About 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium
3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 4135411) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| PubChem CID | 4135411 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | CC(C)Cc1no[n+]([O-])c1CC(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-7(2)5-9-10(6-8(3)4)12(13)14-11-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | XEQXTIYORFARET-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The IUPAC name of 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium (CID 4135411) is 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium is CC(C)Cc1no[n+]([O-])c1CC(C)C.
What is the InChIKey of 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The InChIKey is XEQXTIYORFARET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-7(2)5-9-10(6-8(3)4)12(13)14-11-9/h7-8H,5-6H2,1-4H3.
What are the key properties of 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium?
3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium has a molecular weight of 198.27 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(2-methylpropyl)-2-oxido-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 4135411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).