C21H21NO3 — CID 41360286
(3S)-3-phenyl-6-(piperidine-1-carbonyl)-3,4-dihydroisochromen-1-one (PubChem CID 41360286) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3S)-3-phenyl-6-(piperidine-1-carbonyl)-3,4-dihydroisochromen-1-one.
| Compound Name | (3S)-3-phenyl-6-(piperidine-1-carbonyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 41360286 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (3S)-3-phenyl-6-(piperidine-1-carbonyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1O[C@H](c2ccccc2)Cc2cc(C(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C21H21NO3/c23-20(22-11-5-2-6-12-22)16-9-10-18-17(13-16)14-19(25-21(18)24)15-7-3-1-4-8-15/h1,3-4,7-10,13,19H,2,5-6,11-12,14H2/t19-/m0/s1 |
| InChIKey | FXUIQJPNWZEORU-IBGZPJMESA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |