About 2-bromopropanimidamide
2-bromopropanimidamide (PubChem CID 4136188) has the molecular formula C3H7BrN2
and a molecular weight of 151.01 g/mol. Its IUPAC name is 2-bromopropanimidamide.
Molecular Properties
| Compound Name | 2-bromopropanimidamide |
| PubChem CID | 4136188 |
| Molecular Formula | C3H7BrN2 |
| Molecular Weight | 151.01 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | 2-bromopropanimidamide |
| SMILES | [H]/N=C(\N)C(C)Br |
| InChI | InChI=1S/C3H7BrN2/c1-2(4)3(5)6/h2H,1H3,(H3,5,6) |
| InChIKey | YMHRKSPCWUBBSS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.01 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropanimidamide?
The IUPAC name of 2-bromopropanimidamide (CID 4136188) is 2-bromopropanimidamide.
What is the SMILES notation for 2-bromopropanimidamide?
The canonical SMILES for 2-bromopropanimidamide is [H]/N=C(\N)C(C)Br.
What is the InChIKey of 2-bromopropanimidamide?
The InChIKey is YMHRKSPCWUBBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BrN2/c1-2(4)3(5)6/h2H,1H3,(H3,5,6).
What are the key properties of 2-bromopropanimidamide?
2-bromopropanimidamide has a molecular weight of 151.01 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropanimidamide is sourced from PubChem (CID 4136188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).