C15H14F3N5O3 — CID 4136220
ethyl 3,3,3-trifluoro-2-(pyridine-3-carbonylamino)-2-(pyrimidin-2-ylamino)propanoate (PubChem CID 4136220) has the molecular formula C15H14F3N5O3 and a molecular weight of 369.30 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(pyridine-3-carbonylamino)-2-(pyrimidin-2-ylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(pyridine-3-carbonylamino)-2-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 4136220 |
| Molecular Formula | C15H14F3N5O3 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(pyridine-3-carbonylamino)-2-(pyrimidin-2-ylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1cccnc1)(Nc1ncccn1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N5O3/c1-2-26-12(25)14(15(16,17)18,23-13-20-7-4-8-21-13)22-11(24)10-5-3-6-19-9-10/h3-9H,2H2,1H3,(H,22,24)(H,20,21,23) |
| InChIKey | LWSNTJLASHNSGG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|