C24H23N3O4S — CID 41363936
4-[cyclopropyl(methyl)sulfamoyl]-N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)benzamide (PubChem CID 41363936) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[cyclopropyl(methyl)sulfamoyl]-N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)benzamide.
| Compound Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)benzamide |
|---|---|
| PubChem CID | 41363936 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-(1-ethyl-2-oxobenzo[cd]indol-6-yl)benzamide |
| SMILES | CCN1C(=O)c2cccc3c(NC(=O)c4ccc(S(=O)(=O)N(C)C5CC5)cc4)ccc1c23 |
| InChI | InChI=1S/C24H23N3O4S/c1-3-27-21-14-13-20(18-5-4-6-19(22(18)21)24(27)29)25-23(28)15-7-11-17(12-8-15)32(30,31)26(2)16-9-10-16/h4-8,11-14,16H,3,9-10H2,1-2H3,(H,25,28) |
| InChIKey | ALKMNOJRABIMAC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |