C6H2F10O — CID 4136522
2-(difluoromethyl)-2,3,3,4,5,5,6,6-octafluorooxane (PubChem CID 4136522) has the molecular formula C6H2F10O and a molecular weight of 280.06 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3,3,4,5,5,6,6-octafluorooxane.
| Compound Name | 2-(difluoromethyl)-2,3,3,4,5,5,6,6-octafluorooxane |
|---|---|
| PubChem CID | 4136522 |
| Molecular Formula | C6H2F10O |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-(difluoromethyl)-2,3,3,4,5,5,6,6-octafluorooxane |
| SMILES | FC1C(F)(F)C(F)(F)OC(F)(C(F)F)C1(F)F |
| InChI | InChI=1S/C6H2F10O/c7-1-3(10,11)5(14,2(8)9)17-6(15,16)4(1,12)13/h1-2H |
| InChIKey | KKGZCFKMWUXBKQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|