C35H21Cl2F2N2O13-5 — CID 4136921
2-[2-[2-[6-[bis(carboxylatomethyl)amino]-2,3-difluorophenoxy]ethoxy]-N-(carboxylatomethyl)-4-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)anilino]acetate (PubChem CID 4136921) has the molecular formula C35H21Cl2F2N2O13-5 and a molecular weight of 786.46 g/mol. Its IUPAC name is 2-[2-[2-[6-[bis(carboxylatomethyl)amino]-2,3-difluorophenoxy]ethoxy]-N-(carboxylatomethyl)-4-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)anilino]acetate.
| Compound Name | 2-[2-[2-[6-[bis(carboxylatomethyl)amino]-2,3-difluorophenoxy]ethoxy]-N-(carboxylatomethyl)-4-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)anilino]acetate |
|---|---|
| PubChem CID | 4136921 |
| Molecular Formula | C35H21Cl2F2N2O13-5 |
| Molecular Weight | 786.46 g/mol |
| Exact Mass | 785.04 |
| IUPAC Name | 2-[2-[2-[6-[bis(carboxylatomethyl)amino]-2,3-difluorophenoxy]ethoxy]-N-(carboxylatomethyl)-4-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)anilino]acetate |
| SMILES | O=C([O-])CN(CC(=O)[O-])c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc([O-])c(Cl)cc23)cc1OCCOc1c(N(CC(=O)[O-])CC(=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C35H26Cl2F2N2O13/c36-19-8-17-26(10-24(19)42)54-27-11-25(43)20(37)9-18(27)33(17)16-1-3-22(40(12-29(44)45)13-30(46)47)28(7-16)52-5-6-53-35-23(4-2-21(38)34(35)39)41(14-31(48)49)15-32(50)51/h1-4,7-11,42H,5-6,12-15H2,(H,44,45)(H,46,47)(H,48,49)(H,50,51)/p-5 |
| InChIKey | WEOWLZYEZDHFLE-UHFFFAOYSA-I |
| XLogP | -0.71 |
| TPSA | 238.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|