C16H14F3N5O2 — CID 41369796
5,7-dimethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 41369796) has the molecular formula C16H14F3N5O2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 5,7-dimethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-dimethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 41369796 |
| Molecular Formula | C16H14F3N5O2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 5,7-dimethyl-N-[2-(2,2,2-trifluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)Nc3ccccc3OCC(F)(F)F)nc2n1 |
| InChI | InChI=1S/C16H14F3N5O2/c1-9-7-10(2)24-15(20-9)22-13(23-24)14(25)21-11-5-3-4-6-12(11)26-8-16(17,18)19/h3-7H,8H2,1-2H3,(H,21,25) |
| InChIKey | ONJGXHWPLBFRDQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |