C23H23ClN2O3S — CID 41374254
(2R)-2-[(4-chlorophenyl)sulfonylamino]-3-phenyl-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 41374254) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonylamino]-3-phenyl-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-3-phenyl-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 41374254 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-3-phenyl-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@H](NC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-17(19-10-6-3-7-11-19)25-23(27)22(16-18-8-4-2-5-9-18)26-30(28,29)21-14-12-20(24)13-15-21/h2-15,17,22,26H,16H2,1H3,(H,25,27)/t17-,22+/m0/s1 |
| InChIKey | MGEDYFKECMGTCD-HTAPYJJXSA-N |
| XLogP | 4.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |