C24H25ClN2O7 — CID 41375966
(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 41375966) has the molecular formula C24H25ClN2O7 and a molecular weight of 488.92 g/mol. Its IUPAC name is (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 41375966 |
| Molecular Formula | C24H25ClN2O7 |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC[C@H](C)Oc1c(Cl)cc(/C=C2\C(=O)NC(=O)N(c3ccc(OC)cc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C24H25ClN2O7/c1-6-13(2)34-21-17(25)10-14(11-20(21)33-5)9-16-22(28)26-24(30)27(23(16)29)18-8-7-15(31-3)12-19(18)32-4/h7-13H,6H2,1-5H3,(H,26,28,30)/b16-9+/t13-/m0/s1 |
| InChIKey | LOWVPDXYIQPWMZ-WFSQQTBHSA-N |
| XLogP | 4.21 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|