About 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one
2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one (PubChem CID 41376665) has the molecular formula C22H21Cl2N3O
and a molecular weight of 414.34 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one |
| PubChem CID | 41376665 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one |
| SMILES | O=c1ccc(-c2ccc(N3CCCCC3)cc2)nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O/c23-19-9-4-16(14-20(19)24)15-27-22(28)11-10-21(25-27)17-5-7-18(8-6-17)26-12-2-1-3-13-26/h4-11,14H,1-3,12-13,15H2 |
| InChIKey | RXWLOZHAQNZICN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one?
The IUPAC name of 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one (CID 41376665) is 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one is O=c1ccc(-c2ccc(N3CCCCC3)cc2)nn1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one?
The InChIKey is RXWLOZHAQNZICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2N3O/c23-19-9-4-16(14-20(19)24)15-27-22(28)11-10-21(25-27)17-5-7-18(8-6-17)26-12-2-1-3-13-26/h4-11,14H,1-3,12-13,15H2.
What are the key properties of 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one?
2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one has a molecular weight of 414.34 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methyl]-6-(4-piperidin-1-ylphenyl)pyridazin-3-one is sourced from PubChem (CID 41376665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).