C28H30N4O5 — CID 41386898
(8S)-3-(2-methoxyphenyl)-2-propan-2-yl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-pyrazolo[5,1-c][1,2,4]benzotriazin-6-one (PubChem CID 41386898) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is (8S)-3-(2-methoxyphenyl)-2-propan-2-yl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-pyrazolo[5,1-c][1,2,4]benzotriazin-6-one.
| Compound Name | (8S)-3-(2-methoxyphenyl)-2-propan-2-yl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-pyrazolo[5,1-c][1,2,4]benzotriazin-6-one |
|---|---|
| PubChem CID | 41386898 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (8S)-3-(2-methoxyphenyl)-2-propan-2-yl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-pyrazolo[5,1-c][1,2,4]benzotriazin-6-one |
| SMILES | COc1ccccc1-c1c(C(C)C)nn2c3c(nnc12)C(=O)C[C@@H](c1cc(OC)c(OC)c(OC)c1)C3 |
| InChI | InChI=1S/C28H30N4O5/c1-15(2)25-24(18-9-7-8-10-21(18)34-3)28-30-29-26-19(32(28)31-25)11-16(12-20(26)33)17-13-22(35-4)27(37-6)23(14-17)36-5/h7-10,13-16H,11-12H2,1-6H3/t16-/m0/s1 |
| InChIKey | PEWWKSWYDPAWJU-INIZCTEOSA-N |
| XLogP | 4.86 |
| TPSA | 97.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |