C17H21F3N6O3S — CID 4139202
N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4139202) has the molecular formula C17H21F3N6O3S and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4139202 |
| Molecular Formula | C17H21F3N6O3S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]-2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CC(C)c1nc(SCC(=O)NCCCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C17H21F3N6O3S/c1-10(2)15-23-16(25-24-15)30-9-14(27)22-7-3-6-21-12-5-4-11(17(18,19)20)8-13(12)26(28)29/h4-5,8,10,21H,3,6-7,9H2,1-2H3,(H,22,27)(H,23,24,25) |
| InChIKey | GWAZPTWKJSFCNV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|