About N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide
N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide (PubChem CID 4139723) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide |
| PubChem CID | 4139723 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)Cn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C19H20N2O3/c1-14(2)20(12-15-8-4-3-5-9-15)18(22)13-21-16-10-6-7-11-17(16)24-19(21)23/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | GMKTVKKTZLFCQX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide?
The IUPAC name of N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide (CID 4139723) is N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide?
The canonical SMILES for N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide is CC(C)N(Cc1ccccc1)C(=O)Cn1c(=O)oc2ccccc21.
What is the InChIKey of N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide?
The InChIKey is GMKTVKKTZLFCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-14(2)20(12-15-8-4-3-5-9-15)18(22)13-21-16-10-6-7-11-17(16)24-19(21)23/h3-11,14H,12-13H2,1-2H3.
What are the key properties of N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide?
N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide has a molecular weight of 324.38 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(2-oxo-1,3-benzoxazol-3-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 4139723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).