C15H9ClN4 — CID 4140225
2-[(3-chloro-3-phenylprop-2-enylidene)amino]prop-1-ene-1,1,3-tricarbonitrile (PubChem CID 4140225) has the molecular formula C15H9ClN4 and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-[(3-chloro-3-phenylprop-2-enylidene)amino]prop-1-ene-1,1,3-tricarbonitrile.
| Compound Name | 2-[(3-chloro-3-phenylprop-2-enylidene)amino]prop-1-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 4140225 |
| Molecular Formula | C15H9ClN4 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[(3-chloro-3-phenylprop-2-enylidene)amino]prop-1-ene-1,1,3-tricarbonitrile |
| SMILES | N#CCC(/N=C/C=C(Cl)c1ccccc1)=C(C#N)C#N |
| InChI | InChI=1S/C15H9ClN4/c16-14(12-4-2-1-3-5-12)7-9-20-15(6-8-17)13(10-18)11-19/h1-5,7,9H,6H2/b14-7?,20-9+ |
| InChIKey | LUESIVIGJJEORH-RDPRCMAUSA-N |
| XLogP | 3.55 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|