C26H27N3O3S2 — CID 4140620
2-[4-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]butyl]isoindole-1,3-dione (PubChem CID 4140620) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 2-[4-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4140620 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[4-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]butyl]isoindole-1,3-dione |
| SMILES | C=CCn1c(SCCCCN2C(=O)c3ccccc3C2=O)nc2sc3c(c2c1=O)CCC(C)C3 |
| InChI | InChI=1S/C26H27N3O3S2/c1-3-12-29-25(32)21-19-11-10-16(2)15-20(19)34-22(21)27-26(29)33-14-7-6-13-28-23(30)17-8-4-5-9-18(17)24(28)31/h3-5,8-9,16H,1,6-7,10-15H2,2H3 |
| InChIKey | XXBFLOCBKRHSKS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|