C21H22N4O4 — CID 41410358
1-(2-methoxyphenyl)-3-[2-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-yl]urea (PubChem CID 41410358) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-yl]urea |
|---|---|
| PubChem CID | 41410358 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1c2ccccc2nc(=O)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H22N4O4/c1-28-18-11-5-4-10-17(18)22-20(26)24-19-15-8-2-3-9-16(15)23-21(27)25(19)13-14-7-6-12-29-14/h2-5,8-11,14H,6-7,12-13H2,1H3,(H2,22,24,26)/t14-/m0/s1 |
| InChIKey | CNIOOLXXUXCAIZ-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |