C20H17FN4O3 — CID 41411865
(5S)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 41411865) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is (5S)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41411865 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (5S)-3-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](CCc2ccccc2)C(=O)N1Cc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C20H17FN4O3/c21-15-9-7-14(8-10-15)18-23-17(28-24-18)12-25-19(26)16(22-20(25)27)11-6-13-4-2-1-3-5-13/h1-5,7-10,16H,6,11-12H2,(H,22,27)/t16-/m0/s1 |
| InChIKey | PLPZJZOEYHPLOM-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|