About N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide (PubChem CID 41412107) has the molecular formula C17H20F3NO3
and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide |
| PubChem CID | 41412107 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@@H]1COC2(CCCCC2)O1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO3/c18-17(19,20)14-7-3-2-6-13(14)15(22)21-10-12-11-23-16(24-12)8-4-1-5-9-16/h2-3,6-7,12H,1,4-5,8-11H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | YMNFZCHOROUVHE-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide?
The IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide (CID 41412107) is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide?
The canonical SMILES for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide is O=C(NC[C@@H]1COC2(CCCCC2)O1)c1ccccc1C(F)(F)F.
What is the InChIKey of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide?
The InChIKey is YMNFZCHOROUVHE-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H20F3NO3/c18-17(19,20)14-7-3-2-6-13(14)15(22)21-10-12-11-23-16(24-12)8-4-1-5-9-16/h2-3,6-7,12H,1,4-5,8-11H2,(H,21,22)/t12-/m1/s1.
What are the key properties of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide?
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide has a molecular weight of 343.34 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(trifluoromethyl)benzamide is sourced from PubChem (CID 41412107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).