C21H31NO6 — CID 41412174
N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 41412174) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 41412174 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC[C@H]2COC3(CCCC3)O2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H31NO6/c1-4-24-17-11-15(12-18(25-5-2)19(17)26-6-3)20(23)22-13-16-14-27-21(28-16)9-7-8-10-21/h11-12,16H,4-10,13-14H2,1-3H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | BHKPNRVXZAAPAO-INIZCTEOSA-N |
| XLogP | 3.30 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |