C22H20ClN5O — CID 41413162
5-chloro-3-methyl-1-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 41413162) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 5-chloro-3-methyl-1-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-3-methyl-1-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 41413162 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 5-chloro-3-methyl-1-phenyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H20ClN5O/c1-16-20(21(23)28(26-16)19-6-3-2-4-7-19)22(29)24-14-12-17-8-10-18(11-9-17)27-15-5-13-25-27/h2-11,13,15H,12,14H2,1H3,(H,24,29) |
| InChIKey | DHIUJGGRWHGCMG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |