About 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline
2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 4141883) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 4141883 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2ccccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H17N/c1-17-11-14-9-5-6-10-15(14)16(12-17)13-7-3-2-4-8-13/h2-10,16H,11-12H2,1H3 |
| InChIKey | NNVATDBGKYTMIL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline (CID 4141883) is 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline is CN1Cc2ccccc2C(c2ccccc2)C1.
What is the InChIKey of 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is NNVATDBGKYTMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N/c1-17-11-14-9-5-6-10-15(14)16(12-17)13-7-3-2-4-8-13/h2-10,16H,11-12H2,1H3.
What are the key properties of 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 223.32 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 4141883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).