C23H21ClN4O3S — CID 41419934
3-[[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 41419934) has the molecular formula C23H21ClN4O3S and a molecular weight of 468.97 g/mol. Its IUPAC name is 3-[[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41419934 |
| Molecular Formula | C23H21ClN4O3S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-[[4-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C(c1ccc(CN2C(=O)CNC2=O)cc1)N1CCC(c2nc3cc(Cl)ccc3s2)CC1 |
| InChI | InChI=1S/C23H21ClN4O3S/c24-17-5-6-19-18(11-17)26-21(32-19)15-7-9-27(10-8-15)22(30)16-3-1-14(2-4-16)13-28-20(29)12-25-23(28)31/h1-6,11,15H,7-10,12-13H2,(H,25,31) |
| InChIKey | QQZNXCQHAHFFBK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|