About N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide
N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide (PubChem CID 41419993) has the molecular formula C22H22ClN3O3S
and a molecular weight of 443.96 g/mol. Its IUPAC name is N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide.
Molecular Properties
| Compound Name | N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide |
| PubChem CID | 41419993 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC(=O)N1CCC(c2nc3cc(Cl)ccc3s2)CC1 |
| InChI | InChI=1S/C22H22ClN3O3S/c1-29-18-5-3-2-4-16(18)21(28)24-13-20(27)26-10-8-14(9-11-26)22-25-17-12-15(23)6-7-19(17)30-22/h2-7,12,14H,8-11,13H2,1H3,(H,24,28) |
| InChIKey | DTBPOJBNKRSSME-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide?
The IUPAC name of N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide (CID 41419993) is N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide.
What is the SMILES notation for N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide?
The canonical SMILES for N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide is COc1ccccc1C(=O)NCC(=O)N1CCC(c2nc3cc(Cl)ccc3s2)CC1.
What is the InChIKey of N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide?
The InChIKey is DTBPOJBNKRSSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O3S/c1-29-18-5-3-2-4-16(18)21(28)24-13-20(27)26-10-8-14(9-11-26)22-25-17-12-15(23)6-7-19(17)30-22/h2-7,12,14H,8-11,13H2,1H3,(H,24,28).
What are the key properties of N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide?
N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide has a molecular weight of 443.96 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-2-methoxybenzamide is sourced from PubChem (CID 41419993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).