C22H21ClF3N3O2S — CID 4142143
2-[[(3-chlorophenyl)methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]methyl]-N-ethoxy-1,3-thiazole-4-carboxamide (PubChem CID 4142143) has the molecular formula C22H21ClF3N3O2S and a molecular weight of 483.94 g/mol. Its IUPAC name is 2-[[(3-chlorophenyl)methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]methyl]-N-ethoxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(3-chlorophenyl)methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]methyl]-N-ethoxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 4142143 |
| Molecular Formula | C22H21ClF3N3O2S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[[(3-chlorophenyl)methyl-[[3-(trifluoromethyl)phenyl]methyl]amino]methyl]-N-ethoxy-1,3-thiazole-4-carboxamide |
| SMILES | CCONC(=O)c1csc(CN(Cc2cccc(Cl)c2)Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C22H21ClF3N3O2S/c1-2-31-28-21(30)19-14-32-20(27-19)13-29(12-16-6-4-8-18(23)10-16)11-15-5-3-7-17(9-15)22(24,25)26/h3-10,14H,2,11-13H2,1H3,(H,28,30) |
| InChIKey | JOPVWCBNSHDAKQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|