About 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate
5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 4142272) has the molecular formula C14H11N2O3S-
and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate |
| PubChem CID | 4142272 |
| Molecular Formula | C14H11N2O3S- |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | Cc1cc(C)c(C#N)c(SCc2ccc(C(=O)[O-])o2)n1 |
| InChI | InChI=1S/C14H12N2O3S/c1-8-5-9(2)16-13(11(8)6-15)20-7-10-3-4-12(19-10)14(17)18/h3-5H,7H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | IBWUEXZPZVWPIA-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate?
The IUPAC name of 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate (CID 4142272) is 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate.
What is the SMILES notation for 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate?
The canonical SMILES for 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate is Cc1cc(C)c(C#N)c(SCc2ccc(C(=O)[O-])o2)n1.
What is the InChIKey of 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate?
The InChIKey is IBWUEXZPZVWPIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12N2O3S/c1-8-5-9(2)16-13(11(8)6-15)20-7-10-3-4-12(19-10)14(17)18/h3-5H,7H2,1-2H3,(H,17,18)/p-1.
What are the key properties of 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate?
5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate has a molecular weight of 287.32 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanylmethyl]furan-2-carboxylate is sourced from PubChem (CID 4142272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).